About 7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione
7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione (PubChem CID 71067037) has the molecular formula C11H12N2O2
and a molecular weight of 204.23 g/mol. Its IUPAC name is 7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione.
Molecular Properties
| Compound Name | 7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione |
| PubChem CID | 71067037 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione |
| SMILES | CCc1ccc2cc(=O)n(C)c(=O)n2c1 |
| InChI | InChI=1S/C11H12N2O2/c1-3-8-4-5-9-6-10(14)12(2)11(15)13(9)7-8/h4-7H,3H2,1-2H3 |
| InChIKey | JUBWOSGPFCCBAC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 43.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione?
The IUPAC name of 7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione (CID 71067037) is 7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione.
What is the SMILES notation for 7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione?
The canonical SMILES for 7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione is CCc1ccc2cc(=O)n(C)c(=O)n2c1.
What is the InChIKey of 7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione?
The InChIKey is JUBWOSGPFCCBAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O2/c1-3-8-4-5-9-6-10(14)12(2)11(15)13(9)7-8/h4-7H,3H2,1-2H3.
What are the key properties of 7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione?
7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione has a molecular weight of 204.23 g/mol, XLogP of 0.56, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-2-methylpyrido[1,2-c]pyrimidine-1,3-dione is sourced from PubChem (CID 71067037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).