C11H11F3O2 — CID 71067079
(Z)-1-cyclohexa-2,4-dien-1-yl-4,4,4-trifluoro-3-methoxybut-2-en-1-one (PubChem CID 71067079) has the molecular formula C11H11F3O2 and a molecular weight of 232.20 g/mol. Its IUPAC name is (Z)-1-cyclohexa-2,4-dien-1-yl-4,4,4-trifluoro-3-methoxybut-2-en-1-one.
| Compound Name | (Z)-1-cyclohexa-2,4-dien-1-yl-4,4,4-trifluoro-3-methoxybut-2-en-1-one |
|---|---|
| PubChem CID | 71067079 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (Z)-1-cyclohexa-2,4-dien-1-yl-4,4,4-trifluoro-3-methoxybut-2-en-1-one |
| SMILES | CO/C(=C\C(=O)C1C=CC=CC1)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O2/c1-16-10(11(12,13)14)7-9(15)8-5-3-2-4-6-8/h2-5,7-8H,6H2,1H3/b10-7- |
| InChIKey | KRZPXSMLBLQXTH-YFHOEESVSA-N |
| XLogP | 2.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|