C23H16Cl2F3NO2S2 — CID 71068202
N-[3-[(3,8-dichloro-6H-benzo[c][1]benzothiepin-11-ylidene)methyl]phenyl]-2,2,2-trifluoroethanesulfonamide (PubChem CID 71068202) has the molecular formula C23H16Cl2F3NO2S2 and a molecular weight of 530.42 g/mol. Its IUPAC name is N-[3-[(3,8-dichloro-6H-benzo[c][1]benzothiepin-11-ylidene)methyl]phenyl]-2,2,2-trifluoroethanesulfonamide.
| Compound Name | N-[3-[(3,8-dichloro-6H-benzo[c][1]benzothiepin-11-ylidene)methyl]phenyl]-2,2,2-trifluoroethanesulfonamide |
|---|---|
| PubChem CID | 71068202 |
| Molecular Formula | C23H16Cl2F3NO2S2 |
| Molecular Weight | 530.42 g/mol |
| Exact Mass | 529.00 |
| IUPAC Name | N-[3-[(3,8-dichloro-6H-benzo[c][1]benzothiepin-11-ylidene)methyl]phenyl]-2,2,2-trifluoroethanesulfonamide |
| SMILES | O=S(=O)(CC(F)(F)F)Nc1cccc(C=C2c3ccc(Cl)cc3CSc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C23H16Cl2F3NO2S2/c24-16-4-6-19-15(10-16)12-32-22-11-17(25)5-7-20(22)21(19)9-14-2-1-3-18(8-14)29-33(30,31)13-23(26,27)28/h1-11,29H,12-13H2 |
| InChIKey | ZAGSAUAOXQTLEE-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.42 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|