C29H46N4O4 — CID 71068288
N-cyclopropyl-2-[(3S,15S,16S,20R)-2,14-dioxo-3-piperidin-1-yl-1,13-diazatricyclo[13.6.0.016,20]henicosan-12-yl]-2-oxoacetamide (PubChem CID 71068288) has the molecular formula C29H46N4O4 and a molecular weight of 514.71 g/mol. Its IUPAC name is N-cyclopropyl-2-[(3S,15S,16S,20R)-2,14-dioxo-3-piperidin-1-yl-1,13-diazatricyclo[13.6.0.016,20]henicosan-12-yl]-2-oxoacetamide.
| Compound Name | N-cyclopropyl-2-[(3S,15S,16S,20R)-2,14-dioxo-3-piperidin-1-yl-1,13-diazatricyclo[13.6.0.016,20]henicosan-12-yl]-2-oxoacetamide |
|---|---|
| PubChem CID | 71068288 |
| Molecular Formula | C29H46N4O4 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.35 |
| IUPAC Name | N-cyclopropyl-2-[(3S,15S,16S,20R)-2,14-dioxo-3-piperidin-1-yl-1,13-diazatricyclo[13.6.0.016,20]henicosan-12-yl]-2-oxoacetamide |
| SMILES | O=C(NC1CC1)C(=O)C1CCCCCCCC[C@H](N2CCCCC2)C(=O)N2C[C@@H]3CCC[C@@H]3[C@H]2C(=O)N1 |
| InChI | InChI=1S/C29H46N4O4/c34-26(28(36)30-21-15-16-21)23-13-6-3-1-2-4-7-14-24(32-17-8-5-9-18-32)29(37)33-19-20-11-10-12-22(20)25(33)27(35)31-23/h20-25H,1-19H2,(H,30,36)(H,31,35)/t20-,22-,23?,24-,25-/m0/s1 |
| InChIKey | SAQWLTVPPZSLFQ-YCOFGKDHSA-N |
| XLogP | 2.93 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|