About 3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide
3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide (PubChem CID 71068354) has the molecular formula C13H24F2N2O
and a molecular weight of 262.34 g/mol. Its IUPAC name is 3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide.
Molecular Properties
| Compound Name | 3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide |
| PubChem CID | 71068354 |
| Molecular Formula | C13H24F2N2O |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide |
| SMILES | CCCC(N[C@H](C)CC)C(F)(F)C(=O)NC1CC1 |
| InChI | InChI=1S/C13H24F2N2O/c1-4-6-11(16-9(3)5-2)13(14,15)12(18)17-10-7-8-10/h9-11,16H,4-8H2,1-3H3,(H,17,18)/t9-,11?/m1/s1 |
| InChIKey | GVVPCECVHYJPKK-BFHBGLAWSA-N |
| XLogP | 2.46 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide?
The IUPAC name of 3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide (CID 71068354) is 3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide.
What is the SMILES notation for 3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide?
The canonical SMILES for 3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide is CCCC(N[C@H](C)CC)C(F)(F)C(=O)NC1CC1.
What is the InChIKey of 3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide?
The InChIKey is GVVPCECVHYJPKK-BFHBGLAWSA-N. The full InChI is InChI=1S/C13H24F2N2O/c1-4-6-11(16-9(3)5-2)13(14,15)12(18)17-10-7-8-10/h9-11,16H,4-8H2,1-3H3,(H,17,18)/t9-,11?/m1/s1.
What are the key properties of 3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide?
3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide has a molecular weight of 262.34 g/mol, XLogP of 2.46, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(2R)-butan-2-yl]amino]-N-cyclopropyl-2,2-difluorohexanamide is sourced from PubChem (CID 71068354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).