C21H33FO3 — CID 71068695
(2R,4R,6R,7R,9R,14S)-4-(3-fluoropropyl)-6-hydroxy-9-methoxy-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one (PubChem CID 71068695) has the molecular formula C21H33FO3 and a molecular weight of 352.49 g/mol. Its IUPAC name is (2R,4R,6R,7R,9R,14S)-4-(3-fluoropropyl)-6-hydroxy-9-methoxy-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one.
| Compound Name | (2R,4R,6R,7R,9R,14S)-4-(3-fluoropropyl)-6-hydroxy-9-methoxy-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one |
|---|---|
| PubChem CID | 71068695 |
| Molecular Formula | C21H33FO3 |
| Molecular Weight | 352.49 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (2R,4R,6R,7R,9R,14S)-4-(3-fluoropropyl)-6-hydroxy-9-methoxy-2,4-dimethyltetracyclo[5.4.4.01,8.07,14]pentadecan-3-one |
| SMILES | COC1CCC23CC[C@H]4C[C@@]4(C12)[C@H](O)C[C@@](C)(CCCF)C(=O)[C@@H]3C |
| InChI | InChI=1S/C21H33FO3/c1-13-18(24)19(2,7-4-10-22)12-16(23)21-11-14(21)5-8-20(13)9-6-15(25-3)17(20)21/h13-17,23H,4-12H2,1-3H3/t13-,14-,15?,16+,17?,19+,20?,21-/m0/s1 |
| InChIKey | SBZZULILHQIMCR-AVBVMJRRSA-N |
| XLogP | 3.92 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |