C19H28N2O5S — CID 71068828
N-[(2S)-1-[butyl-[(3R)-4-oxooxathiolan-3-yl]amino]-4,4-dimethyl-1-oxopentan-2-yl]furan-3-carboxamide (PubChem CID 71068828) has the molecular formula C19H28N2O5S and a molecular weight of 396.51 g/mol. Its IUPAC name is N-[(2S)-1-[butyl-[(3R)-4-oxooxathiolan-3-yl]amino]-4,4-dimethyl-1-oxopentan-2-yl]furan-3-carboxamide.
| Compound Name | N-[(2S)-1-[butyl-[(3R)-4-oxooxathiolan-3-yl]amino]-4,4-dimethyl-1-oxopentan-2-yl]furan-3-carboxamide |
|---|---|
| PubChem CID | 71068828 |
| Molecular Formula | C19H28N2O5S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-[(2S)-1-[butyl-[(3R)-4-oxooxathiolan-3-yl]amino]-4,4-dimethyl-1-oxopentan-2-yl]furan-3-carboxamide |
| SMILES | CCCCN(C(=O)[C@H](CC(C)(C)C)NC(=O)c1ccoc1)[C@@H]1SOCC1=O |
| InChI | InChI=1S/C19H28N2O5S/c1-5-6-8-21(18-15(22)12-26-27-18)17(24)14(10-19(2,3)4)20-16(23)13-7-9-25-11-13/h7,9,11,14,18H,5-6,8,10,12H2,1-4H3,(H,20,23)/t14-,18+/m0/s1 |
| InChIKey | ZNGYKHISKGKWEC-KBXCAEBGSA-N |
| XLogP | 3.02 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|