C10H22N2O2+2 — CID 7106894
ethyl 2-[(2R)-1,4-dimethylpiperazine-1,4-diium-2-yl]acetate (PubChem CID 7106894) has the molecular formula C10H22N2O2+2 and a molecular weight of 202.30 g/mol. Its IUPAC name is ethyl 2-[(2R)-1,4-dimethylpiperazine-1,4-diium-2-yl]acetate.
| Compound Name | ethyl 2-[(2R)-1,4-dimethylpiperazine-1,4-diium-2-yl]acetate |
|---|---|
| PubChem CID | 7106894 |
| Molecular Formula | C10H22N2O2+2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | ethyl 2-[(2R)-1,4-dimethylpiperazine-1,4-diium-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1C[NH+](C)CC[NH+]1C |
| InChI | InChI=1S/C10H20N2O2/c1-4-14-10(13)7-9-8-11(2)5-6-12(9)3/h9H,4-8H2,1-3H3/p+2/t9-/m1/s1 |
| InChIKey | YFKTVYCBQXXUNL-SECBINFHSA-P |
| XLogP | -2.65 |
| TPSA | 35.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | -2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |