C16H18O3 — CID 71069213
9a-hydroxy-2,6-dimethyl-2,3,4,4a-tetrahydro-1H-anthracene-9,10-dione (PubChem CID 71069213) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is 9a-hydroxy-2,6-dimethyl-2,3,4,4a-tetrahydro-1H-anthracene-9,10-dione.
| Compound Name | 9a-hydroxy-2,6-dimethyl-2,3,4,4a-tetrahydro-1H-anthracene-9,10-dione |
|---|---|
| PubChem CID | 71069213 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 9a-hydroxy-2,6-dimethyl-2,3,4,4a-tetrahydro-1H-anthracene-9,10-dione |
| SMILES | Cc1ccc2c(c1)C(=O)C1CCC(C)CC1(O)C2=O |
| InChI | InChI=1S/C16H18O3/c1-9-3-5-11-12(7-9)14(17)13-6-4-10(2)8-16(13,19)15(11)18/h3,5,7,10,13,19H,4,6,8H2,1-2H3 |
| InChIKey | ALNLASJNZBWLIX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|