C14H19NO5 — CID 71069226
(4R)-4-(4-butoxycyclohexa-2,4-dien-1-yl)-2-oxo-1,3-oxazolidine-5-carboxylic acid (PubChem CID 71069226) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is (4R)-4-(4-butoxycyclohexa-2,4-dien-1-yl)-2-oxo-1,3-oxazolidine-5-carboxylic acid.
| Compound Name | (4R)-4-(4-butoxycyclohexa-2,4-dien-1-yl)-2-oxo-1,3-oxazolidine-5-carboxylic acid |
|---|---|
| PubChem CID | 71069226 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | (4R)-4-(4-butoxycyclohexa-2,4-dien-1-yl)-2-oxo-1,3-oxazolidine-5-carboxylic acid |
| SMILES | CCCCOC1=CCC([C@H]2NC(=O)OC2C(=O)O)C=C1 |
| InChI | InChI=1S/C14H19NO5/c1-2-3-8-19-10-6-4-9(5-7-10)11-12(13(16)17)20-14(18)15-11/h4,6-7,9,11-12H,2-3,5,8H2,1H3,(H,15,18)(H,16,17)/t9?,11-,12?/m1/s1 |
| InChIKey | RSSQEXIYDVCEPA-CKBZRRDASA-N |
| XLogP | 1.82 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|