C25H31N5O4S — CID 71069399
3-[[4-[[(1R)-1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropyl]amino]-1,2,5-thiadiazol-3-yl]-methylamino]-2-hydroxy-N,N,6-trimethylbenzamide (PubChem CID 71069399) has the molecular formula C25H31N5O4S and a molecular weight of 497.62 g/mol. Its IUPAC name is 3-[[4-[[(1R)-1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropyl]amino]-1,2,5-thiadiazol-3-yl]-methylamino]-2-hydroxy-N,N,6-trimethylbenzamide.
| Compound Name | 3-[[4-[[(1R)-1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropyl]amino]-1,2,5-thiadiazol-3-yl]-methylamino]-2-hydroxy-N,N,6-trimethylbenzamide |
|---|---|
| PubChem CID | 71069399 |
| Molecular Formula | C25H31N5O4S |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.21 |
| IUPAC Name | 3-[[4-[[(1R)-1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropyl]amino]-1,2,5-thiadiazol-3-yl]-methylamino]-2-hydroxy-N,N,6-trimethylbenzamide |
| SMILES | Cc1ccc(N(C)c2nsnc2N[C@@H](c2ccc3c(c2)OCO3)C(C)(C)C)c(O)c1C(=O)N(C)C |
| InChI | InChI=1S/C25H31N5O4S/c1-14-8-10-16(20(31)19(14)24(32)29(5)6)30(7)23-22(27-35-28-23)26-21(25(2,3)4)15-9-11-17-18(12-15)34-13-33-17/h8-12,21,31H,13H2,1-7H3,(H,26,27)/t21-/m0/s1 |
| InChIKey | IUMWHLUNOSNOAJ-NRFANRHFSA-N |
| XLogP | 4.95 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |