About 8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline
8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline (PubChem CID 71069576) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline.
Molecular Properties
| Compound Name | 8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline |
| PubChem CID | 71069576 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline |
| SMILES | CCC(C)(C)C1=CC=CC2C=CC=NC12 |
| InChI | InChI=1S/C14H19N/c1-4-14(2,3)12-9-5-7-11-8-6-10-15-13(11)12/h5-11,13H,4H2,1-3H3 |
| InChIKey | MJDYDTKFVJRCBZ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline?
The IUPAC name of 8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline (CID 71069576) is 8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline.
What is the SMILES notation for 8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline?
The canonical SMILES for 8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline is CCC(C)(C)C1=CC=CC2C=CC=NC12.
What is the InChIKey of 8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline?
The InChIKey is MJDYDTKFVJRCBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-4-14(2,3)12-9-5-7-11-8-6-10-15-13(11)12/h5-11,13H,4H2,1-3H3.
What are the key properties of 8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline?
8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline has a molecular weight of 201.31 g/mol, XLogP of 3.54, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-methylbutan-2-yl)-4a,8a-dihydroquinoline is sourced from PubChem (CID 71069576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).