About 5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide
5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide (PubChem CID 71069685) has the molecular formula C10H15FN2O2S
and a molecular weight of 246.31 g/mol. Its IUPAC name is 5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide.
Molecular Properties
| Compound Name | 5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide |
| PubChem CID | 71069685 |
| Molecular Formula | C10H15FN2O2S |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide |
| SMILES | CNCc1ccc(F)cc1S(=O)(=O)N(C)C |
| InChI | InChI=1S/C10H15FN2O2S/c1-12-7-8-4-5-9(11)6-10(8)16(14,15)13(2)3/h4-6,12H,7H2,1-3H3 |
| InChIKey | SZCUAXRJSMDLJY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide?
The IUPAC name of 5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide (CID 71069685) is 5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide.
What is the SMILES notation for 5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide?
The canonical SMILES for 5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide is CNCc1ccc(F)cc1S(=O)(=O)N(C)C.
What is the InChIKey of 5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide?
The InChIKey is SZCUAXRJSMDLJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15FN2O2S/c1-12-7-8-4-5-9(11)6-10(8)16(14,15)13(2)3/h4-6,12H,7H2,1-3H3.
What are the key properties of 5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide?
5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide has a molecular weight of 246.31 g/mol, XLogP of 0.80, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N,N-dimethyl-2-(methylaminomethyl)benzenesulfonamide is sourced from PubChem (CID 71069685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).