About 9H-xanthene
9H-xanthene (PubChem CID 7107) has the molecular formula C13H10O
and a molecular weight of 182.22 g/mol. Its IUPAC name is 9H-xanthene.
Molecular Properties
| Compound Name | 9H-xanthene |
| PubChem CID | 7107 |
| Molecular Formula | C13H10O |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 9H-xanthene |
| SMILES | c1ccc2c(c1)Cc1ccccc1O2 |
| InChI | InChI=1S/C13H10O/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-8H,9H2 |
| InChIKey | GJCOSYZMQJWQCA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9H-xanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-xanthene?
The IUPAC name of 9H-xanthene (CID 7107) is 9H-xanthene.
What is the SMILES notation for 9H-xanthene?
The canonical SMILES for 9H-xanthene is c1ccc2c(c1)Cc1ccccc1O2.
What is the InChIKey of 9H-xanthene?
The InChIKey is GJCOSYZMQJWQCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-8H,9H2.
What are the key properties of 9H-xanthene?
9H-xanthene has a molecular weight of 182.22 g/mol, XLogP of 3.38, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-xanthene is sourced from PubChem (CID 7107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).