C32H40ClN3O6 — CID 71070027
2-morpholin-4-ylethyl 6-(4-butoxy-2-chlorophenyl)-1-hydroxy-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxylate (PubChem CID 71070027) has the molecular formula C32H40ClN3O6 and a molecular weight of 598.14 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl 6-(4-butoxy-2-chlorophenyl)-1-hydroxy-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxylate.
| Compound Name | 2-morpholin-4-ylethyl 6-(4-butoxy-2-chlorophenyl)-1-hydroxy-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 71070027 |
| Molecular Formula | C32H40ClN3O6 |
| Molecular Weight | 598.14 g/mol |
| Exact Mass | 597.26 |
| IUPAC Name | 2-morpholin-4-ylethyl 6-(4-butoxy-2-chlorophenyl)-1-hydroxy-9,9-dimethyl-7-oxo-6,8,10,11-tetrahydrobenzo[b][1,4]benzodiazepine-5-carboxylate |
| SMILES | CCCCOc1ccc(C2C3=C(CC(C)(C)CC3=O)Nc3c(O)cccc3N2C(=O)OCCN2CCOCC2)c(Cl)c1 |
| InChI | InChI=1S/C32H40ClN3O6/c1-4-5-14-41-21-9-10-22(23(33)18-21)30-28-24(19-32(2,3)20-27(28)38)34-29-25(7-6-8-26(29)37)36(30)31(39)42-17-13-35-11-15-40-16-12-35/h6-10,18,30,34,37H,4-5,11-17,19-20H2,1-3H3 |
| InChIKey | DYNVRPXWIALGLN-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 100.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.14 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|