About 1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine
1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine (PubChem CID 71070191) has the molecular formula C14H14F3N
and a molecular weight of 253.27 g/mol. Its IUPAC name is 1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine.
Molecular Properties
| Compound Name | 1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine |
| PubChem CID | 71070191 |
| Molecular Formula | C14H14F3N |
| Molecular Weight | 253.27 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine |
| SMILES | FC(F)(F)C1=CC(/N=C/C2C=CC=CC2)CC=C1 |
| InChI | InChI=1S/C14H14F3N/c15-14(16,17)12-7-4-8-13(9-12)18-10-11-5-2-1-3-6-11/h1-5,7,9-11,13H,6,8H2/b18-10+ |
| InChIKey | ZSBGCFYDQZCLMQ-VCHYOVAHSA-N |
| XLogP | 4.01 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine?
The IUPAC name of 1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine (CID 71070191) is 1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine.
What is the SMILES notation for 1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine?
The canonical SMILES for 1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine is FC(F)(F)C1=CC(/N=C/C2C=CC=CC2)CC=C1.
What is the InChIKey of 1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine?
The InChIKey is ZSBGCFYDQZCLMQ-VCHYOVAHSA-N. The full InChI is InChI=1S/C14H14F3N/c15-14(16,17)12-7-4-8-13(9-12)18-10-11-5-2-1-3-6-11/h1-5,7,9-11,13H,6,8H2/b18-10+.
What are the key properties of 1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine?
1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine has a molecular weight of 253.27 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-2,4-dien-1-yl-N-[3-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]methanimine is sourced from PubChem (CID 71070191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).