C12H15NO3 — CID 71070389
(1R,2S,5R,6S,7R)-6-acetyl-2,7-dimethyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one (PubChem CID 71070389) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is (1R,2S,5R,6S,7R)-6-acetyl-2,7-dimethyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one.
| Compound Name | (1R,2S,5R,6S,7R)-6-acetyl-2,7-dimethyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
|---|---|
| PubChem CID | 71070389 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (1R,2S,5R,6S,7R)-6-acetyl-2,7-dimethyl-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-en-4-one |
| SMILES | CC(=O)[C@H]1[C@H]2C(=O)N[C@@H](C)[C@@]23C=C[C@@]1(C)O3 |
| InChI | InChI=1S/C12H15NO3/c1-6(14)8-9-10(15)13-7(2)12(9)5-4-11(8,3)16-12/h4-5,7-9H,1-3H3,(H,13,15)/t7-,8-,9-,11+,12-/m0/s1 |
| InChIKey | ABZFGLVUBANEBH-VXIZUSDNSA-N |
| XLogP | 0.42 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|