About 5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate
5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate (PubChem CID 71070664) has the molecular formula C7H6F3O2S-
and a molecular weight of 211.18 g/mol. Its IUPAC name is 5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate.
Molecular Properties
| Compound Name | 5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate |
| PubChem CID | 71070664 |
| Molecular Formula | C7H6F3O2S- |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.00 |
| IUPAC Name | 5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate |
| SMILES | O=S([O-])C1C=CC=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C7H7F3O2S/c8-7(9,10)5-2-1-3-6(4-5)13(11)12/h1-3,6H,4H2,(H,11,12)/p-1 |
| InChIKey | GDGTVWNVNVDLII-UHFFFAOYSA-M |
| XLogP | 1.68 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate?
The IUPAC name of 5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate (CID 71070664) is 5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate.
What is the SMILES notation for 5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate?
The canonical SMILES for 5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate is O=S([O-])C1C=CC=C(C(F)(F)F)C1.
What is the InChIKey of 5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate?
The InChIKey is GDGTVWNVNVDLII-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H7F3O2S/c8-7(9,10)5-2-1-3-6(4-5)13(11)12/h1-3,6H,4H2,(H,11,12)/p-1.
What are the key properties of 5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate?
5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate has a molecular weight of 211.18 g/mol, XLogP of 1.68, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfinate is sourced from PubChem (CID 71070664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).