C23H25N5O2 — CID 71070899
2-[3-(2-aminopyrimidin-5-yl)phenyl]-N-[(2-morpholin-4-ylphenyl)methyl]acetamide (PubChem CID 71070899) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is 2-[3-(2-aminopyrimidin-5-yl)phenyl]-N-[(2-morpholin-4-ylphenyl)methyl]acetamide.
| Compound Name | 2-[3-(2-aminopyrimidin-5-yl)phenyl]-N-[(2-morpholin-4-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 71070899 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 2-[3-(2-aminopyrimidin-5-yl)phenyl]-N-[(2-morpholin-4-ylphenyl)methyl]acetamide |
| SMILES | Nc1ncc(-c2cccc(CC(=O)NCc3ccccc3N3CCOCC3)c2)cn1 |
| InChI | InChI=1S/C23H25N5O2/c24-23-26-15-20(16-27-23)18-6-3-4-17(12-18)13-22(29)25-14-19-5-1-2-7-21(19)28-8-10-30-11-9-28/h1-7,12,15-16H,8-11,13-14H2,(H,25,29)(H2,24,26,27) |
| InChIKey | LSNDVXUVYCCBHX-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |