About butan-1-ol;2-butyl-N-methylcyclobutan-1-amine
butan-1-ol;2-butyl-N-methylcyclobutan-1-amine (PubChem CID 71071171) has the molecular formula C13H29NO
and a molecular weight of 215.38 g/mol. Its IUPAC name is butan-1-ol;2-butyl-N-methylcyclobutan-1-amine.
Molecular Properties
| Compound Name | butan-1-ol;2-butyl-N-methylcyclobutan-1-amine |
| PubChem CID | 71071171 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | butan-1-ol;2-butyl-N-methylcyclobutan-1-amine |
| SMILES | CCCCC1CCC1NC.CCCCO |
| InChI | InChI=1S/C9H19N.C4H10O/c1-3-4-5-8-6-7-9(8)10-2;1-2-3-4-5/h8-10H,3-7H2,1-2H3;5H,2-4H2,1H3 |
| InChIKey | OLPJZIHMVZJWLB-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butan-1-ol;2-butyl-N-methylcyclobutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-ol;2-butyl-N-methylcyclobutan-1-amine?
The IUPAC name of butan-1-ol;2-butyl-N-methylcyclobutan-1-amine (CID 71071171) is butan-1-ol;2-butyl-N-methylcyclobutan-1-amine.
What is the SMILES notation for butan-1-ol;2-butyl-N-methylcyclobutan-1-amine?
The canonical SMILES for butan-1-ol;2-butyl-N-methylcyclobutan-1-amine is CCCCC1CCC1NC.CCCCO.
What is the InChIKey of butan-1-ol;2-butyl-N-methylcyclobutan-1-amine?
The InChIKey is OLPJZIHMVZJWLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C4H10O/c1-3-4-5-8-6-7-9(8)10-2;1-2-3-4-5/h8-10H,3-7H2,1-2H3;5H,2-4H2,1H3.
What are the key properties of butan-1-ol;2-butyl-N-methylcyclobutan-1-amine?
butan-1-ol;2-butyl-N-methylcyclobutan-1-amine has a molecular weight of 215.38 g/mol, XLogP of 2.95, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-ol;2-butyl-N-methylcyclobutan-1-amine is sourced from PubChem (CID 71071171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).