About 2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol
2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol (PubChem CID 71071266) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol |
| PubChem CID | 71071266 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol |
| SMILES | CC1CCCCCC(C)C1N(C)CCO |
| InChI | InChI=1S/C13H27NO/c1-11-7-5-4-6-8-12(2)13(11)14(3)9-10-15/h11-13,15H,4-10H2,1-3H3 |
| InChIKey | OIIXEPXXWPXZLR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol?
The IUPAC name of 2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol (CID 71071266) is 2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol.
What is the SMILES notation for 2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol?
The canonical SMILES for 2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol is CC1CCCCCC(C)C1N(C)CCO.
What is the InChIKey of 2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol?
The InChIKey is OIIXEPXXWPXZLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-11-7-5-4-6-8-12(2)13(11)14(3)9-10-15/h11-13,15H,4-10H2,1-3H3.
What are the key properties of 2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol?
2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol has a molecular weight of 213.36 g/mol, XLogP of 2.52, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,8-dimethylcyclooctyl)-methylamino]ethanol is sourced from PubChem (CID 71071266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).