C14H31NO — CID 71071624
N,2-diethylcycloheptan-1-amine;propan-1-ol (PubChem CID 71071624) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is N,2-diethylcycloheptan-1-amine;propan-1-ol.
| Compound Name | N,2-diethylcycloheptan-1-amine;propan-1-ol |
|---|---|
| PubChem CID | 71071624 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | N,2-diethylcycloheptan-1-amine;propan-1-ol |
| SMILES | CCCO.CCNC1CCCCCC1CC |
| InChI | InChI=1S/C11H23N.C3H8O/c1-3-10-8-6-5-7-9-11(10)12-4-2;1-2-3-4/h10-12H,3-9H2,1-2H3;4H,2-3H2,1H3 |
| InChIKey | JBWBRJYBIQUBST-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |