C27H39N3O5Si — CID 71072338
[(3S,4R)-5-azido-4,6-diethoxy-3-methoxyoxan-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 71072338) has the molecular formula C27H39N3O5Si and a molecular weight of 513.71 g/mol. Its IUPAC name is [(3S,4R)-5-azido-4,6-diethoxy-3-methoxyoxan-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(3S,4R)-5-azido-4,6-diethoxy-3-methoxyoxan-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 71072338 |
| Molecular Formula | C27H39N3O5Si |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.27 |
| IUPAC Name | [(3S,4R)-5-azido-4,6-diethoxy-3-methoxyoxan-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | CCOC1OC(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@@H](OC)[C@H](OCC)C1N=[N+]=[N-] |
| InChI | InChI=1S/C27H39N3O5Si/c1-7-32-25-23(29-30-28)26(33-8-2)35-22(24(25)31-6)19-34-36(27(3,4)5,20-15-11-9-12-16-20)21-17-13-10-14-18-21/h9-18,22-26H,7-8,19H2,1-6H3/t22?,23?,24-,25-,26?/m1/s1 |
| InChIKey | GGKAHCWCSHEKPA-WBIOGEFZSA-N |
| XLogP | 4.42 |
| TPSA | 94.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|