C14H22BrNO3Si — CID 71072364
[5-(5-bromo-2-nitrophenyl)-2-methylpentan-2-yl]-hydroxy-dimethylsilane (PubChem CID 71072364) has the molecular formula C14H22BrNO3Si and a molecular weight of 360.32 g/mol. Its IUPAC name is [5-(5-bromo-2-nitrophenyl)-2-methylpentan-2-yl]-hydroxy-dimethylsilane.
| Compound Name | [5-(5-bromo-2-nitrophenyl)-2-methylpentan-2-yl]-hydroxy-dimethylsilane |
|---|---|
| PubChem CID | 71072364 |
| Molecular Formula | C14H22BrNO3Si |
| Molecular Weight | 360.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [5-(5-bromo-2-nitrophenyl)-2-methylpentan-2-yl]-hydroxy-dimethylsilane |
| SMILES | CC(C)(CCCc1cc(Br)ccc1[N+](=O)[O-])[Si](C)(C)O |
| InChI | InChI=1S/C14H22BrNO3Si/c1-14(2,20(3,4)19)9-5-6-11-10-12(15)7-8-13(11)16(17)18/h7-8,10,19H,5-6,9H2,1-4H3 |
| InChIKey | RQIOGSHIXNYSGY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|