C19H19Cl2N5 — CID 71072478
3-[(6R,8aS)-6-[2-(2,4-dichlorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazin-2-amine (PubChem CID 71072478) has the molecular formula C19H19Cl2N5 and a molecular weight of 388.30 g/mol. Its IUPAC name is 3-[(6R,8aS)-6-[2-(2,4-dichlorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazin-2-amine.
| Compound Name | 3-[(6R,8aS)-6-[2-(2,4-dichlorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 71072478 |
| Molecular Formula | C19H19Cl2N5 |
| Molecular Weight | 388.30 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 3-[(6R,8aS)-6-[2-(2,4-dichlorophenyl)ethynyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]pyrazin-2-amine |
| SMILES | Nc1nccnc1N1CCN2[C@@H](CC[C@@H]2C#Cc2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C19H19Cl2N5/c20-14-3-1-13(17(21)11-14)2-4-15-5-6-16-12-25(9-10-26(15)16)19-18(22)23-7-8-24-19/h1,3,7-8,11,15-16H,5-6,9-10,12H2,(H2,22,23)/t15-,16-/m0/s1 |
| InChIKey | IPVKMOBGTJUXLU-HOTGVXAUSA-N |
| XLogP | 3.07 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.30 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|