C22H28N6O2S2 — CID 71072801
1-ethyl-3-[3-[4-(4-morpholin-4-ylphenyl)-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-3-yl]propyl]urea (PubChem CID 71072801) has the molecular formula C22H28N6O2S2 and a molecular weight of 472.64 g/mol. Its IUPAC name is 1-ethyl-3-[3-[4-(4-morpholin-4-ylphenyl)-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-3-yl]propyl]urea.
| Compound Name | 1-ethyl-3-[3-[4-(4-morpholin-4-ylphenyl)-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-3-yl]propyl]urea |
|---|---|
| PubChem CID | 71072801 |
| Molecular Formula | C22H28N6O2S2 |
| Molecular Weight | 472.64 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | 1-ethyl-3-[3-[4-(4-morpholin-4-ylphenyl)-2-(1,3-thiazol-2-ylimino)-1,3-thiazol-3-yl]propyl]urea |
| SMILES | CCNC(=O)NCCCn1c(-c2ccc(N3CCOCC3)cc2)csc1=Nc1nccs1 |
| InChI | InChI=1S/C22H28N6O2S2/c1-2-23-20(29)24-8-3-10-28-19(16-32-22(28)26-21-25-9-15-31-21)17-4-6-18(7-5-17)27-11-13-30-14-12-27/h4-7,9,15-16H,2-3,8,10-14H2,1H3,(H2,23,24,29) |
| InChIKey | HMXNKYORPXVVLA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|