C20H32N6O3S — CID 71073135
N'-amino-N-(methylideneamino)-4-[3-[(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl)oxy]propyl]piperidine-1-carboximidamide (PubChem CID 71073135) has the molecular formula C20H32N6O3S and a molecular weight of 436.58 g/mol. Its IUPAC name is N'-amino-N-(methylideneamino)-4-[3-[(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl)oxy]propyl]piperidine-1-carboximidamide.
| Compound Name | N'-amino-N-(methylideneamino)-4-[3-[(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl)oxy]propyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 71073135 |
| Molecular Formula | C20H32N6O3S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N'-amino-N-(methylideneamino)-4-[3-[(2-methylsulfonyl-3,4-dihydro-1H-isoquinolin-6-yl)oxy]propyl]piperidine-1-carboximidamide |
| SMILES | C=NNC(=NN)N1CCC(CCCOc2ccc3c(c2)CCN(S(C)(=O)=O)C3)CC1 |
| InChI | InChI=1S/C20H32N6O3S/c1-22-24-20(23-21)25-10-7-16(8-11-25)4-3-13-29-19-6-5-18-15-26(30(2,27)28)12-9-17(18)14-19/h5-6,14,16H,1,3-4,7-13,15,21H2,2H3,(H,23,24) |
| InChIKey | CIGRZCYJZWEUSB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 112.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|