C38H39F3N2O6 — CID 71073188
1-[2-[4-[(3,4-difluorophenyl)methoxy]-2-fluorophenyl]-6-hydroxy-4-(3-hydroxy-2,2-dimethylpropyl)-3-methyl-2,5-dihydro-1,5-benzodiazepin-1-yl]-2-(2,5-dimethoxyphenyl)ethanone (PubChem CID 71073188) has the molecular formula C38H39F3N2O6 and a molecular weight of 676.73 g/mol. Its IUPAC name is 1-[2-[4-[(3,4-difluorophenyl)methoxy]-2-fluorophenyl]-6-hydroxy-4-(3-hydroxy-2,2-dimethylpropyl)-3-methyl-2,5-dihydro-1,5-benzodiazepin-1-yl]-2-(2,5-dimethoxyphenyl)ethanone.
| Compound Name | 1-[2-[4-[(3,4-difluorophenyl)methoxy]-2-fluorophenyl]-6-hydroxy-4-(3-hydroxy-2,2-dimethylpropyl)-3-methyl-2,5-dihydro-1,5-benzodiazepin-1-yl]-2-(2,5-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 71073188 |
| Molecular Formula | C38H39F3N2O6 |
| Molecular Weight | 676.73 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | 1-[2-[4-[(3,4-difluorophenyl)methoxy]-2-fluorophenyl]-6-hydroxy-4-(3-hydroxy-2,2-dimethylpropyl)-3-methyl-2,5-dihydro-1,5-benzodiazepin-1-yl]-2-(2,5-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(OC)c(CC(=O)N2c3cccc(O)c3NC(CC(C)(C)CO)=C(C)C2c2ccc(OCc3ccc(F)c(F)c3)cc2F)c1 |
| InChI | InChI=1S/C38H39F3N2O6/c1-22-31(19-38(2,3)21-44)42-36-32(7-6-8-33(36)45)43(35(46)17-24-16-25(47-4)11-14-34(24)48-5)37(22)27-12-10-26(18-29(27)40)49-20-23-9-13-28(39)30(41)15-23/h6-16,18,37,42,44-45H,17,19-21H2,1-5H3 |
| InChIKey | FJMDENDHGQBYST-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.73 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|