About 3-trityl-1,3-oxazolidin-5-one
3-trityl-1,3-oxazolidin-5-one (PubChem CID 7107390) has the molecular formula C22H19NO2
and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-trityl-1,3-oxazolidin-5-one.
Molecular Properties
| Compound Name | 3-trityl-1,3-oxazolidin-5-one |
| PubChem CID | 7107390 |
| Molecular Formula | C22H19NO2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3-trityl-1,3-oxazolidin-5-one |
| SMILES | O=C1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CO1 |
| InChI | InChI=1S/C22H19NO2/c24-21-16-23(17-25-21)22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17H2 |
| InChIKey | MLOBYZUIPXPCOL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze 3-trityl-1,3-oxazolidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trityl-1,3-oxazolidin-5-one?
The IUPAC name of 3-trityl-1,3-oxazolidin-5-one (CID 7107390) is 3-trityl-1,3-oxazolidin-5-one.
What is the SMILES notation for 3-trityl-1,3-oxazolidin-5-one?
The canonical SMILES for 3-trityl-1,3-oxazolidin-5-one is O=C1CN(C(c2ccccc2)(c2ccccc2)c2ccccc2)CO1.
What is the InChIKey of 3-trityl-1,3-oxazolidin-5-one?
The InChIKey is MLOBYZUIPXPCOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19NO2/c24-21-16-23(17-25-21)22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17H2.
What are the key properties of 3-trityl-1,3-oxazolidin-5-one?
3-trityl-1,3-oxazolidin-5-one has a molecular weight of 329.40 g/mol, XLogP of 3.79, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trityl-1,3-oxazolidin-5-one is sourced from PubChem (CID 7107390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).