C36H36N6O — CID 71074341
2,3-dimethyl-N-[(1S)-1-(3-propan-2-ylphenyl)ethyl]-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]indole-5-carboxamide (PubChem CID 71074341) has the molecular formula C36H36N6O and a molecular weight of 568.73 g/mol. Its IUPAC name is 2,3-dimethyl-N-[(1S)-1-(3-propan-2-ylphenyl)ethyl]-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-N-[(1S)-1-(3-propan-2-ylphenyl)ethyl]-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 71074341 |
| Molecular Formula | C36H36N6O |
| Molecular Weight | 568.73 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | 2,3-dimethyl-N-[(1S)-1-(3-propan-2-ylphenyl)ethyl]-1-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3-c3nn[nH]n3)cc2)c2ccc(C(=O)N[C@@H](C)c3cccc(C(C)C)c3)cc12 |
| InChI | InChI=1S/C36H36N6O/c1-22(2)28-9-8-10-29(19-28)24(4)37-36(43)30-17-18-34-33(20-30)23(3)25(5)42(34)21-26-13-15-27(16-14-26)31-11-6-7-12-32(31)35-38-40-41-39-35/h6-20,22,24H,21H2,1-5H3,(H,37,43)(H,38,39,40,41)/t24-/m0/s1 |
| InChIKey | PDYBKPLDGSBFND-DEOSSOPVSA-N |
| XLogP | 7.77 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.73 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|