C35H33N3O3 — CID 71074560
2-[4-[[5-[1-(6-cyclopropyl-2-pyridinyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 71074560) has the molecular formula C35H33N3O3 and a molecular weight of 543.67 g/mol. Its IUPAC name is 2-[4-[[5-[1-(6-cyclopropyl-2-pyridinyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-[1-(6-cyclopropyl-2-pyridinyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71074560 |
| Molecular Formula | C35H33N3O3 |
| Molecular Weight | 543.67 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 2-[4-[[5-[1-(6-cyclopropyl-2-pyridinyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(C(=O)NC(C)c3cccc(C4CC4)n3)cc12 |
| InChI | InChI=1S/C35H33N3O3/c1-21-23(3)38(20-24-11-13-25(14-12-24)28-7-4-5-8-29(28)35(40)41)33-18-17-27(19-30(21)33)34(39)36-22(2)31-9-6-10-32(37-31)26-15-16-26/h4-14,17-19,22,26H,15-16,20H2,1-3H3,(H,36,39)(H,40,41) |
| InChIKey | BZYJVCPCETVFBR-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.67 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|