C39H39N3O5 — CID 71074620
2-[4-[[2,3-dimethyl-5-[[(1S)-1-[(2S)-1-phenylmethoxycarbonylpyrrolidin-2-yl]ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 71074620) has the molecular formula C39H39N3O5 and a molecular weight of 629.76 g/mol. Its IUPAC name is 2-[4-[[2,3-dimethyl-5-[[(1S)-1-[(2S)-1-phenylmethoxycarbonylpyrrolidin-2-yl]ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2,3-dimethyl-5-[[(1S)-1-[(2S)-1-phenylmethoxycarbonylpyrrolidin-2-yl]ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71074620 |
| Molecular Formula | C39H39N3O5 |
| Molecular Weight | 629.76 g/mol |
| Exact Mass | 629.29 |
| IUPAC Name | 2-[4-[[2,3-dimethyl-5-[[(1S)-1-[(2S)-1-phenylmethoxycarbonylpyrrolidin-2-yl]ethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(C(=O)N[C@@H](C)[C@@H]3CCCN3C(=O)OCc3ccccc3)cc12 |
| InChI | InChI=1S/C39H39N3O5/c1-25-27(3)42(23-28-15-17-30(18-16-28)32-12-7-8-13-33(32)38(44)45)36-20-19-31(22-34(25)36)37(43)40-26(2)35-14-9-21-41(35)39(46)47-24-29-10-5-4-6-11-29/h4-8,10-13,15-20,22,26,35H,9,14,21,23-24H2,1-3H3,(H,40,43)(H,44,45)/t26-,35-/m0/s1 |
| InChIKey | YDGOJIBKRJNRJU-CYFIQEHSSA-N |
| XLogP | 7.59 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.76 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|