C34H30N2O4 — CID 71074686
2-[4-[[5-(3,4-dihydro-2H-chromen-3-ylcarbamoyl)-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 71074686) has the molecular formula C34H30N2O4 and a molecular weight of 530.62 g/mol. Its IUPAC name is 2-[4-[[5-(3,4-dihydro-2H-chromen-3-ylcarbamoyl)-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-(3,4-dihydro-2H-chromen-3-ylcarbamoyl)-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71074686 |
| Molecular Formula | C34H30N2O4 |
| Molecular Weight | 530.62 g/mol |
| Exact Mass | 530.22 |
| IUPAC Name | 2-[4-[[5-(3,4-dihydro-2H-chromen-3-ylcarbamoyl)-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(C(=O)NC3COc4ccccc4C3)cc12 |
| InChI | InChI=1S/C34H30N2O4/c1-21-22(2)36(19-23-11-13-24(14-12-23)28-8-4-5-9-29(28)34(38)39)31-16-15-26(18-30(21)31)33(37)35-27-17-25-7-3-6-10-32(25)40-20-27/h3-16,18,27H,17,19-20H2,1-2H3,(H,35,37)(H,38,39) |
| InChIKey | XPCLROUCHIPBSJ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|