About 1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate
1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate (PubChem CID 71074993) has the molecular formula C16H22BrN3O3
and a molecular weight of 384.27 g/mol. Its IUPAC name is 1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate.
Molecular Properties
| Compound Name | 1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate |
| PubChem CID | 71074993 |
| Molecular Formula | C16H22BrN3O3 |
| Molecular Weight | 384.27 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | 1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate |
| SMILES | CCOC(C)=O.Cc1nccn2c(C3CCOCC3)nc(Br)c12 |
| InChI | InChI=1S/C12H14BrN3O.C4H8O2/c1-8-10-11(13)15-12(16(10)5-4-14-8)9-2-6-17-7-3-9;1-3-6-4(2)5/h4-5,9H,2-3,6-7H2,1H3;3H2,1-2H3 |
| InChIKey | OUPJUWMOLGCPTE-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate?
The IUPAC name of 1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate (CID 71074993) is 1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate.
What is the SMILES notation for 1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate?
The canonical SMILES for 1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate is CCOC(C)=O.Cc1nccn2c(C3CCOCC3)nc(Br)c12.
What is the InChIKey of 1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate?
The InChIKey is OUPJUWMOLGCPTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrN3O.C4H8O2/c1-8-10-11(13)15-12(16(10)5-4-14-8)9-2-6-17-7-3-9;1-3-6-4(2)5/h4-5,9H,2-3,6-7H2,1H3;3H2,1-2H3.
What are the key properties of 1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate?
1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate has a molecular weight of 384.27 g/mol, XLogP of 3.26, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-8-methyl-3-(oxan-4-yl)imidazo[1,5-a]pyrazine;ethyl acetate is sourced from PubChem (CID 71074993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).