C34H30N2O5 — CID 71075120
2-[4-[[5-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamoyl)-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 71075120) has the molecular formula C34H30N2O5 and a molecular weight of 546.62 g/mol. Its IUPAC name is 2-[4-[[5-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamoyl)-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamoyl)-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71075120 |
| Molecular Formula | C34H30N2O5 |
| Molecular Weight | 546.62 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 2-[4-[[5-(2,3-dihydro-1,4-benzodioxin-3-ylmethylcarbamoyl)-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(C(=O)NCC3COc4ccccc4O3)cc12 |
| InChI | InChI=1S/C34H30N2O5/c1-21-22(2)36(19-23-11-13-24(14-12-23)27-7-3-4-8-28(27)34(38)39)30-16-15-25(17-29(21)30)33(37)35-18-26-20-40-31-9-5-6-10-32(31)41-26/h3-17,26H,18-20H2,1-2H3,(H,35,37)(H,38,39) |
| InChIKey | CFDHTBAARCMHPE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.62 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|