C27H26F2N2O — CID 71075321
1-[(2,4-difluorophenyl)methyl]-2,3-dimethyl-N-(1-phenylpropyl)indole-5-carboxamide (PubChem CID 71075321) has the molecular formula C27H26F2N2O and a molecular weight of 432.51 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-2,3-dimethyl-N-(1-phenylpropyl)indole-5-carboxamide.
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-2,3-dimethyl-N-(1-phenylpropyl)indole-5-carboxamide |
|---|---|
| PubChem CID | 71075321 |
| Molecular Formula | C27H26F2N2O |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-2,3-dimethyl-N-(1-phenylpropyl)indole-5-carboxamide |
| SMILES | CCC(NC(=O)c1ccc2c(c1)c(C)c(C)n2Cc1ccc(F)cc1F)c1ccccc1 |
| InChI | InChI=1S/C27H26F2N2O/c1-4-25(19-8-6-5-7-9-19)30-27(32)20-11-13-26-23(14-20)17(2)18(3)31(26)16-21-10-12-22(28)15-24(21)29/h5-15,25H,4,16H2,1-3H3,(H,30,32) |
| InChIKey | BLRMZPQNLCVHEV-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|