C7H15N4S2+ — CID 7107534
3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl-dimethylazanium (PubChem CID 7107534) has the molecular formula C7H15N4S2+ and a molecular weight of 219.36 g/mol. Its IUPAC name is 3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl-dimethylazanium.
| Compound Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7107534 |
| Molecular Formula | C7H15N4S2+ |
| Molecular Weight | 219.36 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCSc1nnc(N)s1 |
| InChI | InChI=1S/C7H14N4S2/c1-11(2)4-3-5-12-7-10-9-6(8)13-7/h3-5H2,1-2H3,(H2,8,9)/p+1 |
| InChIKey | RROQWVYFDYMUJL-UHFFFAOYSA-O |
| XLogP | -0.25 |
| TPSA | 56.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.36 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|