C29H28BrClN2O4 — CID 71075365
(2S)-2-[5-[[5-[[(1S)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]-2-chlorophenoxy]propanoic acid (PubChem CID 71075365) has the molecular formula C29H28BrClN2O4 and a molecular weight of 583.91 g/mol. Its IUPAC name is (2S)-2-[5-[[5-[[(1S)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]-2-chlorophenoxy]propanoic acid.
| Compound Name | (2S)-2-[5-[[5-[[(1S)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]-2-chlorophenoxy]propanoic acid |
|---|---|
| PubChem CID | 71075365 |
| Molecular Formula | C29H28BrClN2O4 |
| Molecular Weight | 583.91 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | (2S)-2-[5-[[5-[[(1S)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]-2-chlorophenoxy]propanoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(Cl)c(O[C@@H](C)C(=O)O)c2)c2ccc(C(=O)N[C@@H](C)c3ccc(Br)cc3)cc12 |
| InChI | InChI=1S/C29H28BrClN2O4/c1-16-18(3)33(15-20-5-11-25(31)27(13-20)37-19(4)29(35)36)26-12-8-22(14-24(16)26)28(34)32-17(2)21-6-9-23(30)10-7-21/h5-14,17,19H,15H2,1-4H3,(H,32,34)(H,35,36)/t17-,19-/m0/s1 |
| InChIKey | ODGSDUIOJXTQJF-HKUYNNGSSA-N |
| XLogP | 7.07 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.91 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|