C19H21NO2 — CID 71076138
1,6,10-trimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol (PubChem CID 71076138) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 1,6,10-trimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol.
| Compound Name | 1,6,10-trimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol |
|---|---|
| PubChem CID | 71076138 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 1,6,10-trimethyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,9-diol |
| SMILES | Cc1cc2c(cc1O)CC1c3c(cc(O)c(C)c3-2)CCN1C |
| InChI | InChI=1S/C19H21NO2/c1-10-6-14-13(9-16(10)21)7-15-19-12(4-5-20(15)3)8-17(22)11(2)18(14)19/h6,8-9,15,21-22H,4-5,7H2,1-3H3 |
| InChIKey | WMSNWPQGQMDDSU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |