C27H30Br2N4O — CID 71076544
8,18-dibromo-10-methoxy-3,3,7,13,13,17-hexamethyl-2,12,22,24-tetrahydroporphyrin (PubChem CID 71076544) has the molecular formula C27H30Br2N4O and a molecular weight of 586.37 g/mol. Its IUPAC name is 8,18-dibromo-10-methoxy-3,3,7,13,13,17-hexamethyl-2,12,22,24-tetrahydroporphyrin.
| Compound Name | 8,18-dibromo-10-methoxy-3,3,7,13,13,17-hexamethyl-2,12,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 71076544 |
| Molecular Formula | C27H30Br2N4O |
| Molecular Weight | 586.37 g/mol |
| Exact Mass | 584.08 |
| IUPAC Name | 8,18-dibromo-10-methoxy-3,3,7,13,13,17-hexamethyl-2,12,22,24-tetrahydroporphyrin |
| SMILES | COc1c2nc(cc3[nH]c(cc4nc(cc5[nH]c1c(Br)c5C)C(C)(C)C4)c(Br)c3C)C(C)(C)C2 |
| InChI | InChI=1S/C27H30Br2N4O/c1-13-16-9-21-27(5,6)12-19(32-21)25(34-7)24-23(29)14(2)17(33-24)10-20-26(3,4)11-15(30-20)8-18(31-16)22(13)28/h8-10,31,33H,11-12H2,1-7H3/b15-8-,16-9-,17-10-,18-8-,20-10-,21-9-,25-19+,25-24+ |
| InChIKey | FTVYRVIFLYSFST-OFDDMETOSA-N |
| XLogP | 7.51 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.37 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |