C26H28Br2N4 — CID 71076679
8,18-dibromo-3,3,7,13,13,17-hexamethyl-2,12,22,24-tetrahydroporphyrin (PubChem CID 71076679) has the molecular formula C26H28Br2N4 and a molecular weight of 556.35 g/mol. Its IUPAC name is 8,18-dibromo-3,3,7,13,13,17-hexamethyl-2,12,22,24-tetrahydroporphyrin.
| Compound Name | 8,18-dibromo-3,3,7,13,13,17-hexamethyl-2,12,22,24-tetrahydroporphyrin |
|---|---|
| PubChem CID | 71076679 |
| Molecular Formula | C26H28Br2N4 |
| Molecular Weight | 556.35 g/mol |
| Exact Mass | 554.07 |
| IUPAC Name | 8,18-dibromo-3,3,7,13,13,17-hexamethyl-2,12,22,24-tetrahydroporphyrin |
| SMILES | Cc1c(Br)c2cc3nc(cc4[nH]c(cc5nc(cc1[nH]2)C(C)(C)C5)c(Br)c4C)C(C)(C)C3 |
| InChI | InChI=1S/C26H28Br2N4/c1-13-17-9-21-25(3,4)12-16(29-21)8-20-24(28)14(2)18(32-20)10-22-26(5,6)11-15(30-22)7-19(31-17)23(13)27/h7-10,31-32H,11-12H2,1-6H3/b15-7-,16-8-,17-9-,18-10-,19-7-,20-8-,21-9-,22-10- |
| InChIKey | SQGJPGKXUJGHNP-FKAUBEGXSA-N |
| XLogP | 7.50 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.35 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |