C20H21N3O2 — CID 71076714
5-[2-(dimethylamino)ethoxy]-13-methyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13-heptaen-16-one (PubChem CID 71076714) has the molecular formula C20H21N3O2 and a molecular weight of 335.41 g/mol. Its IUPAC name is 5-[2-(dimethylamino)ethoxy]-13-methyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13-heptaen-16-one.
| Compound Name | 5-[2-(dimethylamino)ethoxy]-13-methyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13-heptaen-16-one |
|---|---|
| PubChem CID | 71076714 |
| Molecular Formula | C20H21N3O2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 5-[2-(dimethylamino)ethoxy]-13-methyl-11,15-diazatetracyclo[8.7.0.02,7.012,17]heptadeca-1(10),2(7),3,5,8,12(17),13-heptaen-16-one |
| SMILES | Cc1c[nH]c(=O)c2c1[nH]c1ccc3cc(OCCN(C)C)ccc3c12 |
| InChI | InChI=1S/C20H21N3O2/c1-12-11-21-20(24)18-17-15-6-5-14(25-9-8-23(2)3)10-13(15)4-7-16(17)22-19(12)18/h4-7,10-11,22H,8-9H2,1-3H3,(H,21,24) |
| InChIKey | CFZQXHXBFDAHQW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |