C24H30O6 — CID 71076842
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[6-[(4-methoxyphenyl)methyl]-7-methyl-2,3-dihydro-1H-inden-4-yl]oxane-3,4,5-triol (PubChem CID 71076842) has the molecular formula C24H30O6 and a molecular weight of 414.50 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[6-[(4-methoxyphenyl)methyl]-7-methyl-2,3-dihydro-1H-inden-4-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[6-[(4-methoxyphenyl)methyl]-7-methyl-2,3-dihydro-1H-inden-4-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71076842 |
| Molecular Formula | C24H30O6 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[6-[(4-methoxyphenyl)methyl]-7-methyl-2,3-dihydro-1H-inden-4-yl]oxane-3,4,5-triol |
| SMILES | COc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3c(c2C)CCC3)cc1 |
| InChI | InChI=1S/C24H30O6/c1-13-15(10-14-6-8-16(29-2)9-7-14)11-19(18-5-3-4-17(13)18)24-23(28)22(27)21(26)20(12-25)30-24/h6-9,11,20-28H,3-5,10,12H2,1-2H3/t20-,21-,22+,23-,24+/m1/s1 |
| InChIKey | GUKIVDOSBYFYLU-SJSRKZJXSA-N |
| XLogP | 1.60 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |