C23H28ClNO6 — CID 71076920
(2S,3R,4R,5S,6R)-2-[4-chloro-5-[[4-(dimethylamino)phenyl]methyl]-2,3-dihydro-1-benzofuran-7-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71076920) has the molecular formula C23H28ClNO6 and a molecular weight of 449.93 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-5-[[4-(dimethylamino)phenyl]methyl]-2,3-dihydro-1-benzofuran-7-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-5-[[4-(dimethylamino)phenyl]methyl]-2,3-dihydro-1-benzofuran-7-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71076920 |
| Molecular Formula | C23H28ClNO6 |
| Molecular Weight | 449.93 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-5-[[4-(dimethylamino)phenyl]methyl]-2,3-dihydro-1-benzofuran-7-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CN(C)c1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3c(c2Cl)CCO3)cc1 |
| InChI | InChI=1S/C23H28ClNO6/c1-25(2)14-5-3-12(4-6-14)9-13-10-16(22-15(18(13)24)7-8-30-22)23-21(29)20(28)19(27)17(11-26)31-23/h3-6,10,17,19-21,23,26-29H,7-9,11H2,1-2H3/t17-,19-,20+,21-,23+/m1/s1 |
| InChIKey | PEPKERYTUSCZDG-SQKWCZRTSA-N |
| XLogP | 1.45 |
| TPSA | 102.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.93 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|