About 6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid
6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 71077230) has the molecular formula C19H13ClF2N2O4
and a molecular weight of 406.77 g/mol. Its IUPAC name is 6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid |
| PubChem CID | 71077230 |
| Molecular Formula | C19H13ClF2N2O4 |
| Molecular Weight | 406.77 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | O=C(Cc1c(F)cccc1F)NCc1cc(Cl)cc2cc(C(=O)O)c(=O)[nH]c12 |
| InChI | InChI=1S/C19H13ClF2N2O4/c20-11-4-9-6-13(19(27)28)18(26)24-17(9)10(5-11)8-23-16(25)7-12-14(21)2-1-3-15(12)22/h1-6H,7-8H2,(H,23,25)(H,24,26)(H,27,28) |
| InChIKey | JXDDVRVGHQISAW-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.77 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid?
The IUPAC name of 6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid (CID 71077230) is 6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid.
What is the SMILES notation for 6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid?
The canonical SMILES for 6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid is O=C(Cc1c(F)cccc1F)NCc1cc(Cl)cc2cc(C(=O)O)c(=O)[nH]c12.
What is the InChIKey of 6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid?
The InChIKey is JXDDVRVGHQISAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13ClF2N2O4/c20-11-4-9-6-13(19(27)28)18(26)24-17(9)10(5-11)8-23-16(25)7-12-14(21)2-1-3-15(12)22/h1-6H,7-8H2,(H,23,25)(H,24,26)(H,27,28).
What are the key properties of 6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid?
6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid has a molecular weight of 406.77 g/mol, XLogP of 3.02, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-8-[[[2-(2,6-difluorophenyl)acetyl]amino]methyl]-2-oxo-1H-quinoline-3-carboxylic acid is sourced from PubChem (CID 71077230), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).