About methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate
methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate (PubChem CID 71077354) has the molecular formula C20H16ClF2N3O4
and a molecular weight of 435.81 g/mol. Its IUPAC name is methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate |
| PubChem CID | 71077354 |
| Molecular Formula | C20H16ClF2N3O4 |
| Molecular Weight | 435.81 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate |
| SMILES | COC(=O)c1cc2cc(Cl)cc(CNC(=O)Nc3c(F)cccc3F)c2nc1OC |
| InChI | InChI=1S/C20H16ClF2N3O4/c1-29-18-13(19(27)30-2)8-10-6-12(21)7-11(16(10)25-18)9-24-20(28)26-17-14(22)4-3-5-15(17)23/h3-8H,9H2,1-2H3,(H2,24,26,28) |
| InChIKey | KMINFCXGHCTAQL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate?
The IUPAC name of methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate (CID 71077354) is methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate.
What is the SMILES notation for methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate?
The canonical SMILES for methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate is COC(=O)c1cc2cc(Cl)cc(CNC(=O)Nc3c(F)cccc3F)c2nc1OC.
What is the InChIKey of methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate?
The InChIKey is KMINFCXGHCTAQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16ClF2N3O4/c1-29-18-13(19(27)30-2)8-10-6-12(21)7-11(16(10)25-18)9-24-20(28)26-17-14(22)4-3-5-15(17)23/h3-8H,9H2,1-2H3,(H2,24,26,28).
What are the key properties of methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate?
methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate has a molecular weight of 435.81 g/mol, XLogP of 4.28, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chloro-8-[[(2,6-difluorophenyl)carbamoylamino]methyl]-2-methoxyquinoline-3-carboxylate is sourced from PubChem (CID 71077354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).