About methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate
methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate (PubChem CID 71077405) has the molecular formula C21H17ClF2N2O4
and a molecular weight of 434.83 g/mol. Its IUPAC name is methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate.
Molecular Properties
| Compound Name | methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate |
| PubChem CID | 71077405 |
| Molecular Formula | C21H17ClF2N2O4 |
| Molecular Weight | 434.83 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate |
| SMILES | COC(=O)c1cc2cc(Cl)cc(CNC(=O)Cc3cccc(F)c3F)c2nc1OC |
| InChI | InChI=1S/C21H17ClF2N2O4/c1-29-20-15(21(28)30-2)8-12-6-14(22)7-13(19(12)26-20)10-25-17(27)9-11-4-3-5-16(23)18(11)24/h3-8H,9-10H2,1-2H3,(H,25,27) |
| InChIKey | OILVFWZKLUVOMG-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 434.83 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate?
The IUPAC name of methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate (CID 71077405) is methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate.
What is the SMILES notation for methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate?
The canonical SMILES for methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate is COC(=O)c1cc2cc(Cl)cc(CNC(=O)Cc3cccc(F)c3F)c2nc1OC.
What is the InChIKey of methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate?
The InChIKey is OILVFWZKLUVOMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClF2N2O4/c1-29-20-15(21(28)30-2)8-12-6-14(22)7-13(19(12)26-20)10-25-17(27)9-11-4-3-5-16(23)18(11)24/h3-8H,9-10H2,1-2H3,(H,25,27).
What are the key properties of methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate?
methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate has a molecular weight of 434.83 g/mol, XLogP of 3.82, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chloro-8-[[[2-(2,3-difluorophenyl)acetyl]amino]methyl]-2-methoxyquinoline-3-carboxylate is sourced from PubChem (CID 71077405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).