C33H41N5O3 — CID 71078245
[3-(2-acetamidoethyl)-1-(1H-indol-5-yl)-7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl] carbamate (PubChem CID 71078245) has the molecular formula C33H41N5O3 and a molecular weight of 555.72 g/mol. Its IUPAC name is [3-(2-acetamidoethyl)-1-(1H-indol-5-yl)-7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl] carbamate.
| Compound Name | [3-(2-acetamidoethyl)-1-(1H-indol-5-yl)-7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl] carbamate |
|---|---|
| PubChem CID | 71078245 |
| Molecular Formula | C33H41N5O3 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.32 |
| IUPAC Name | [3-(2-acetamidoethyl)-1-(1H-indol-5-yl)-7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl] carbamate |
| SMILES | CC(=O)NCCC(CCCCNc1c2c(nc3ccccc13)CCCC2)CC(OC(N)=O)c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C33H41N5O3/c1-22(39)35-18-15-23(20-31(41-33(34)40)25-13-14-28-24(21-25)16-19-36-28)8-6-7-17-37-32-26-9-2-4-11-29(26)38-30-12-5-3-10-27(30)32/h2,4,9,11,13-14,16,19,21,23,31,36H,3,5-8,10,12,15,17-18,20H2,1H3,(H2,34,40)(H,35,39)(H,37,38) |
| InChIKey | YSPYIIMVNQAFBG-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|