C25H27ClF3NO6 — CID 71078275
[(2R,3S,4R,5R,6S)-6-[7-chloro-6-[[4-(methylamino)phenyl]methyl]-2,3-dihydro-1H-inden-4-yl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 2,2,2-trifluoroacetate (PubChem CID 71078275) has the molecular formula C25H27ClF3NO6 and a molecular weight of 529.94 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6S)-6-[7-chloro-6-[[4-(methylamino)phenyl]methyl]-2,3-dihydro-1H-inden-4-yl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(2R,3S,4R,5R,6S)-6-[7-chloro-6-[[4-(methylamino)phenyl]methyl]-2,3-dihydro-1H-inden-4-yl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 71078275 |
| Molecular Formula | C25H27ClF3NO6 |
| Molecular Weight | 529.94 g/mol |
| Exact Mass | 529.15 |
| IUPAC Name | [(2R,3S,4R,5R,6S)-6-[7-chloro-6-[[4-(methylamino)phenyl]methyl]-2,3-dihydro-1H-inden-4-yl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl] 2,2,2-trifluoroacetate |
| SMILES | CNc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](OC(=O)C(F)(F)F)[C@H](O)[C@H]3O)c3c(c2Cl)CCC3)cc1 |
| InChI | InChI=1S/C25H27ClF3NO6/c1-30-14-7-5-12(6-8-14)9-13-10-17(15-3-2-4-16(15)19(13)26)22-20(32)21(33)23(18(11-31)35-22)36-24(34)25(27,28)29/h5-8,10,18,20-23,30-33H,2-4,9,11H2,1H3/t18-,20-,21-,22+,23-/m1/s1 |
| InChIKey | CYTDCBZYASPTQA-FUBOCBINSA-N |
| XLogP | 3.09 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.94 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |