C25H30F2O5 — CID 71078416
(2S,3R,4R,5S,6R)-2-[7-(difluoromethyl)-6-[(4-ethylphenyl)methyl]-2,3-dihydro-1H-inden-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 71078416) has the molecular formula C25H30F2O5 and a molecular weight of 448.51 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[7-(difluoromethyl)-6-[(4-ethylphenyl)methyl]-2,3-dihydro-1H-inden-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[7-(difluoromethyl)-6-[(4-ethylphenyl)methyl]-2,3-dihydro-1H-inden-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 71078416 |
| Molecular Formula | C25H30F2O5 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[7-(difluoromethyl)-6-[(4-ethylphenyl)methyl]-2,3-dihydro-1H-inden-4-yl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCc1ccc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3c(c2C(F)F)CCC3)cc1 |
| InChI | InChI=1S/C25H30F2O5/c1-2-13-6-8-14(9-7-13)10-15-11-18(16-4-3-5-17(16)20(15)25(26)27)24-23(31)22(30)21(29)19(12-28)32-24/h6-9,11,19,21-25,28-31H,2-5,10,12H2,1H3/t19-,21-,22+,23-,24+/m1/s1 |
| InChIKey | PAKAFMZJDDOXDD-ZXGKGEBGSA-N |
| XLogP | 2.78 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |